| Drug name | Ro07-9749 |
|---|---|
| C | 15 |
| H | 10 |
| F | 1 |
| I | 1 |
| N | 2 |
| O | 1 |
| Iupac name | 5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepin-2-one |
| Cas number | 30843-56-2 |
| Chemspiderid | 2339763 |
| Pubchem | 3082318 |
| Smiles | C1C(=O)NC2=C(C=C(C=C2)I)C(=N1)C3=CC=CC=C3F |
| Stdinchi | 1S/C15H10FIN2O/c16-12-4-2-1-3-10(12)15-11-7-9(17)5-6-13(11)19-14(20)8-18-15/h1-7H,8H2,(H,19,20) |
| Stdinchikey | UBSKLVILVGEEON-UHFFFAOYSA-N |
Ro07-9749 is a benzodiazepine derivative with sedative and anxiolytic effects,[1] which has been used as an internal standard in the analysis of other benzodiazepines.[2]
See also
References
- ^ "5-(2-fluorophenyl)-1,3-dihydro-7-iodo-2h-1,4-benzodiazepin-2-one derivatives and their preparation.". No. 35885.
- ^ Greenblatt DJ, Locniskar A, Ochs HR, Lauven PM (August 1981). "Automated gas chromatography for studies of midazolam pharmacokinetics". Anesthesiology. 55 (2): 176–9. doi:10.1097/00000542-198108000-00014. PMID 6114686