| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 448868650 |
| Iupac name | (acetyloxy)methyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Cas number | 983-85-7 |
| Atc prefix | J01 |
| Atc suffix | CE06 |
| Pubchem | 13795 |
| Unii | H0P1YE5581 |
| Chebi | 131733 |
| Kegg | D05406 |
| Chemspiderid | 8426255 |
| C | 19 |
| H | 22 |
| N | 2 |
| O | 6 |
| S | 1 |
| Smiles | CC(=O)OCOC(=O)[C@H]1C(S[C@H]2N1C(=O)[C@H]2NC(=O)CC3=CC=CC=C3)(C)C |
| Stdinchi | 1S/C19H22N2O6S/c1-11(22)26-10-27-18(25)15-19(2,3)28-17-14(16(24)21(15)17)20-13(23)9-12-7-5-4-6-8-12/h4-8,14-15,17H,9-10H2,1-3H3,(H,20,23)/t14-,15+,17-/m1/s1 |
| Stdinchikey | NLOOMWLTUVBWAW-HLLBOEOZSA-N |
Penamecillin, an acetoxymethyl ester of benzylpenicillin, is a prodrug processed to benzylpenicillin by esterases.[1] It has no detectable teratogenic risk to the fetus.[2]
References
- ^ Agersborg HP, Batchelor A, Cambridge GW, Rule AW (March 1966). "The pharmacology of penamecillin". British Journal of Pharmacology and Chemotherapy. 26 (3): 649–655. doi:10.1111/j.1476-5381.1966.tb01844.x. PMC 1510697. PMID 4959939
- ^ Czeizel AE, Rockenbauer M, Sørensen HT, Olsen J (1999). "The Safety of Penicillin V: Oral Penamecillin Use During Pregnancy The Importance and Limitation of Recall Bias". Congenital Anomalies. 39 (4): 267–279. doi:10.1111/j.1741-4520.1999.tb00566.x. ISSN 0914-3505