| Class | Serotonin 5-HT1A receptor biased agonist |
|---|---|
| Atc prefix | None |
| Cas number | 2170564-20-0 |
| Pubchem | 132257041 |
| Chemspiderid | 129067040 |
| Chembl | 5868777 |
| Synonyms | NLX266 |
| Iupac name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-[[2-[(4-fluoro-2-pyridinyl)oxy]ethylamino]methyl]piperidin-1-yl]methanone |
| C | 20 |
| H | 21 |
| Cl | 1 |
| F | 3 |
| N | 3 |
| O | 2 |
| Smiles | C1CN(CCC1(CNCCOC2=NC=CC(=C2)F)F)C(=O)C3=CC(=C(C=C3)F)Cl |
| Stdinchi | 1S/C20H21ClF3N3O2/c21-16-11-14(1-2-17(16)23)19(28)27-8-4-20(24,5-9-27)13-25-7-10-29-18-12-15(22)3-6-26-18/h1-3,6,11-12,25H,4-5,7-10,13H2 |
| Stdinchikey | VGNJZLFABGNCBA-UHFFFAOYSA-N |
NLX-266 is a biased agonist of the serotonin 5-HT1A receptor.[1][2] It acts specifically as a very-high-affinity and selective ERK1/2-biased serotonin 5-HT1A receptor agonist (Ki = 0.0447 nM; EC50 = 0.437 nM; Emax = 94%), with selectivity for ERK1/2 signaling over multiple other pathways.[2] The drug produces antidepressant- and antiparkinsonian-like effects in rodents, with much greater efficacy than certain other serotonin 5-HT1A receptor agonists like buspirone and gepirone.[2] It shows favorable pharmacokinetics in rodents.[2] The chemical synthesis of NLX-266 has been described.[2] NLX-266 was developed by Neurolixis.[1][2] It was first described in the scientific literature in 2025.[2]
See also
References
- ^ "Delving into the Latest Updates on NLX-266 with Synapse". Synapse. 29 November 2025. Retrieved 31 January 2026.
- ^ Sniecikowska J, Gluch-Lutwin M, Bucki A, Gryzlo B, Wieckowski K, Godyn J, Wieckowska A, Siwek A, Jastrzebska-Wiesek M, Partyka A, Cios A, Wesolowska A, Newman-Tancredi A, Kolaczkowski M (May 2025). "Discovery of NLX-266, an Orally Available and Metabolically Stable ERK1/2-Biased 5-HT1AR Agonist with Superior Antidepressant and Antiparkinsonian Activity". Journal of Medicinal Chemistry. 68 (9): 9706–9722. doi:10.1021/acs.jmedchem.5c00484. PMC 12067441. PMID 40267318