| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 400298582 |
| Iupac name | (2Z,4S,4aR,5S,5aR,12aS)-2-[amino(hydroxy)methylene]-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methylene-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2H,4H,5H)-trione |
| Cas number | 914-00-1 |
| Atc prefix | J01 |
| Atc suffix | AA05 |
| Pubchem | 54675785 |
| Chemspiderid | 10468596 |
| Niaid chemdb | 001301 |
| Unii | IR235I7C5P |
| Chembl | 249837 |
| C | 22 |
| H | 22 |
| N | 2 |
| O | 8 |
| Smiles | NC(=O)C=3C(=O)[C@@]4(O)C(\O)=C2\C(=O)c1c(O)cccc1C(=C)[C@H]2[C@H](O)[C@H]4[C@H](N(C)C)C=3O |
| Stdinchi | 1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
| Stdinchikey | MHIGBKBJSQVXNH-IWVLMIASSA-N |
Metacycline or methacycline is a tetracycline antibiotic. It is used as a precursor in the industrial synthesis of doxycycline hyclate.[citation needed]
It has been found to act as an agonist of the human pregnane X receptor ligand-binding domain and to induce CYP3A4 expression in vitro.[1]
References
- ^ Shukla SJ, Sakamuru S, Huang R, Moeller TA, Shinn P, Vanleer D, Auld DS, Austin CP, Xia M (2011). "Identification of clinically used drugs that activate pregnane X receptors". Drug Metab. Dispos.. 39 (1): 151–9. doi:10.1124/dmd.110.035105. PMC 3014269. PMID 20966043. Archived from the original on 2017-12-22. Retrieved 2017-12-20.