| Watchedfields | changed |
|---|---|
| Verifiedrevid | 443864211 |
| Iupac name | 7-Hydroxy-4-methylchromen-2-one |
| Cas number | 90-33-5 |
| Atc prefix | A05 |
| Atc suffix | AX02 |
| Pubchem | 5280567 |
| Drugbank | DB07118 |
| Chemspiderid | 4444190 |
| Unii | 3T5NG4Q468 |
| Kegg | D00170 |
| Chebi | 17224 |
| Chembl | 12208 |
| C | 10 |
| H | 8 |
| O | 3 |
| Smiles | CC1=CC(=O)OC2=C1C=CC(=C2)O |
| Stdinchi | 1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
| Stdinchikey | HSHNITRMYYLLCV-UHFFFAOYSA-N |
| Synonyms | 4-Methylumbelliferone |
Hymecromone (4-methylumbelliferone) is a drug used in bile therapy. It is used as choleretic and antispasmodic drugs and as a standard for the fluorometric determination of enzyme activity.[1]
Hymecromone is a crystalline solid with a melting point of 194–195 °C. It is soluble in methanol and glacial acetic acid.
See also
References
- ^ Yang Y, Hamaguchi K (April 1980). "Hydrolysis of 4-methylumbelliferyl N-acetyl-chitotrioside catalyzed by hen and turkey lysozymes. pH dependence of the kinetics constants". Journal of Biochemistry. 87 (4): 1003–14. doi:10.1093/oxfordjournals.jbchem.a132833. PMID 7390976