| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 443841117 |
| Iupac name | (2S,5R,6R)-6-[[(2R)-2-Amino-2-(1-cyclohexa-1,4-dienyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Cas number | 26774-90-3 |
| Atc prefix | J01 |
| Atc suffix | CA07 |
| Pubchem | 71392 |
| Unii | 3LU1L73C8Y |
| Chemspiderid | 64486 |
| Smiles | O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](C/1=C/C\C=C/C\1)N)[C@H]3SC2(C)C |
| Stdinchi | 1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 |
| Stdinchikey | RPBAFSBGYDKNRG-NJBDSQKTSA-N |
| C | 16 |
| H | 21 |
| N | 3 |
| O | 4 |
| S | 1 |
Epicillin (INN) is a penicillin antibiotic. It is not approved by the FDA for use in the United States.[citation needed]
It is an aminopenicillin.[1][2]
References
- ^ Bergan T (1979). "Studies on aminopenicillin developments. Proceedings of a symposium. Concluding remarks". Infection. 7 (Suppl 5): S507-512. doi:10.1007/bf01659785. PMID 389828. S2CID 46974138
- ^ Mombelli G (May 1981). "[Aminopenicillin: when, how, what kind?]" (in German). Schweizerische Medizinische Wochenschrift. 111 (18): 641–5. PMID 7244588