| Verifiedrevid | 443277111 |
|---|---|
| Iupac name | 6-chloro-3-(cyclopentylmethyl)-1,1-dioxo-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide |
| Legal uk | POM |
| Iuphar ligand | 7899 |
| Cas number | 742-20-1 |
| Atc prefix | C03 |
| Atc suffix | AA07 |
| Pubchem | 2904 |
| Chembl | 1373254 |
| Unii | VX4S2N85F5 |
| Kegg | D02061 |
| Chemspiderid | 2801 |
| Smiles | O=S(=O)(c1c(Cl)cc2c(c1)S(=O)(=O)NC(N2)CC3CCCC3)N |
| Stdinchi | 1S/C13H18ClN3O4S2/c14-9-6-10-12(7-11(9)22(15,18)19)23(20,21)17-13(16-10)5-8-3-1-2-4-8/h6-8,13,16-17H,1-5H2,(H2,15,18,19) |
| Stdinchikey | BKYKPTRYDKTTJY-UHFFFAOYSA-N |
| C | 13 |
| H | 18 |
| Cl | 1 |
| N | 3 |
| O | 4 |
| S | 2 |
Cyclopenthiazide (trade name Navidrex) is a thiazide diuretic used in the treatment of heart failure and hypertension.
Contraindications
Thiazide diuretics increase the excretion of sodium and potassium ions and decrease the excretion of calcium ions and uric acid so they are contraindicated in patients with hyponatraemia, hypokalaemia, hypercalcaemia and hyperuricaemia. They are also contraindicated in patients with Addison's disease.