| Iupac name | (2S,5R,6R)-6-([2-(3,4-dichlorophenyl)-2-methoxyacetyl]amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| Cas number | 1926-49-4 |
| Atc prefix | J01 |
| Atc suffix | CE07 |
| Chebi | 131732 |
| Chembl | 2106548 |
| Pubchem | 71807 |
| Chemspiderid | 64831 |
| Unii | YI8LL014GF |
| Kegg | D07236 |
| C | 17 |
| H | 18 |
| Cl | 2 |
| N | 2 |
| O | 5 |
| S | 1 |
| Smiles | O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)C(OC)c1ccc(Cl)c(Cl)c1)[C@H]3SC2(C)C |
Clometocillin (or clometacillin) is a penicillin.[1][2]
References
- ^ Vanhoof R (September 1998). "Comparative in-vitro activities of amoxycillin and penicillin against Streptococcus pneumoniae isolates". The Journal of Antimicrobial Chemotherapy. 42 (3): 397–8. doi:10.1093/jac/42.3.397. PMID 9786482
- ^ "Clometocillin". Pharmaceutical Manufacturing Encyclopedia. 3rd ed. Norwich, N.Y.: William Andrew Publishing. 2007. p. 1091. ISBN 978-0-8155-1856-3.