| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 460023468 |
| Iupac name | (6R,7S)-7-(2-(cyanomethylthio)acetamido)-7-methoxy-3-((1-methyl-1H-tetrazol-5-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Medlineplus | a601206 |
| Cas number | 56796-20-4 |
| Atc prefix | J01 |
| Atc suffix | DC09 |
| Pubchem | 42008 |
| Drugbank | DB00274 |
| Chemspiderid | 38311 |
| Unii | 3J962UJT8H |
| Kegg | D00910 |
| Chebi | 3489 |
| Chembl | 1201195 |
| C | 15 |
| H | 17 |
| N | 7 |
| O | 5 |
| S | 3 |
| Smiles | O=C2N1/C(=C(\CS[C@@H]1[C@]2(OC)NC(=O)CSCC#N)CSc3nnnn3C)C(=O)O |
| Stdinchi | 1S/C15H17N7O5S3/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25)/t13-,15+/m1/s1 |
| Stdinchikey | SNBUBQHDYVFSQF-HIFRSBDPSA-N |
Cefmetazole is a cephamycin antibiotic, usually grouped with the second-generation cephalosporins.
Adverse effects
The chemical structure of cefmetazole, like that of several other cephalosporins, contains an N-methylthiotetrazole (NMTT or 1-MTT) side chain. As the antibiotic is broken down in the body, it releases free NMTT, which can cause hypoprothrombinemia (likely due to inhibition of the enzyme vitamin K epoxide reductase) and a reaction with ethanol similar to that produced by disulfiram, due to inhibition of aldehyde dehydrogenase.[1]
Spectrum of bacterial susceptibility
Cefmetazole is a broad-spectrum cephalosporin antimicrobial and has been effective in treating bacteria responsible for causing urinary tract and skin infections. [citation needed]The following represents MIC susceptibility data for a few medically significant microorganisms.
- Bacteroides fragilis: 0.06 - >256 μg/ml
- Clostridioides difficile: 8 - >128 μg/ml
- Staphylococcus aureus: 0.5 - 256 μg/ml (includes MRSA)[2]
References
- ^ Stork CM (2006). "Antibiotics, antifungals, and antivirals". Goldfrank's toxicologic emergencies. New York: McGraw-Hill. p. 847. ISBN 0-07-143763-0. Retrieved 2009-07-03.
- ^ "Cefmetazole, free acid Susceptibility and Concentration Range (μg/ml) Minimum Inhibitory Concentration (MIC) Data". The Antimicrobial Index. TOKU-E. 6 January 2020.