| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 444604058 |
| Iupac name | (6R,7S)-7-([(2R,3S)-2-[(4-Ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoyl]amino)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Legal status | Rx-only |
| Routes of administration | IM, IV |
| Cas number | 76610-84-9 |
| Atc prefix | J01 |
| Atc suffix | DC13 |
| Pubchem | 127527 |
| Chembl | 1908372 |
| Unii | T0785J3X40 |
| Kegg | D03423 |
| Chemspiderid | 113142 |
| Smiles | CCN1CCN(C(=O)C1=O)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@]2([C@@H]3N(C2=O)C(=C(CS3)CSC4=NN=NN4C)C(=O)O)OC |
| Stdinchi | 1S/C22H29N9O9S2/c1-5-29-6-7-30(16(35)15(29)34)20(39)23-12(10(2)32)14(33)24-22(40-4)18(38)31-13(17(36)37)11(8-41-19(22)31)9-42-21-25-26-27-28(21)3/h10,12,19,32H,5-9H2,1-4H3,(H,23,39)(H,24,33)(H,36,37)/t10-,12+,19+,22-/m0/s1 |
| Stdinchikey | SMSRCGPDNDCXFR-CYWZMYCQSA-N |
| C | 22 |
| H | 29 |
| N | 9 |
| O | 9 |
| S | 2 |
Cefbuperazone (INN) is a second-generation cephalosporin antibiotic.[1][2]
References
- ^ Izumi K, Kawazoe K, Mikamo H, Ito K, Tamaya T (November 1995). "In vivo bacterial regrowth-inhibition effect of cefbuperazone and amikacin in puerperal uterine cavity". Journal of Chemotherapy. 7 (Suppl 4): 173–6. PMID 8904147
- ^ "Cefbuperazone crystalline triethylamine salt". No. 4754030.